C14H23N5O — CID 63954765
N-(cyclopropylmethyl)-N-ethyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 63954765) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-ethyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-N-ethyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 63954765 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | N-(cyclopropylmethyl)-N-ethyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CCN(CC1CC1)C(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C14H23N5O/c1-2-18(9-11-3-4-11)14(20)13-10-19(17-16-13)12-5-7-15-8-6-12/h10-12,15H,2-9H2,1H3 |
| InChIKey | BRWUKZDMNQYBSE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |