C13H24ClN5O — CID 119737731
N-butan-2-yl-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119737731) has the molecular formula C13H24ClN5O and a molecular weight of 301.82 g/mol. Its IUPAC name is N-butan-2-yl-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-butan-2-yl-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119737731 |
| Molecular Formula | C13H24ClN5O |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-butan-2-yl-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CCC(C)N(C)C(=O)c1cn(C2CCNCC2)nn1.Cl |
| InChI | InChI=1S/C13H23N5O.ClH/c1-4-10(2)17(3)13(19)12-9-18(16-15-12)11-5-7-14-8-6-11;/h9-11,14H,4-8H2,1-3H3;1H |
| InChIKey | XNYSWKGTCJIQCJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |