C14H24ClN5O — CID 119696941
N-cyclopentyl-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride (PubChem CID 119696941) has the molecular formula C14H24ClN5O and a molecular weight of 313.83 g/mol. Its IUPAC name is N-cyclopentyl-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride.
| Compound Name | N-cyclopentyl-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119696941 |
| Molecular Formula | C14H24ClN5O |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-cyclopentyl-N-methyl-1-piperidin-4-yltriazole-4-carboxamide;hydrochloride |
| SMILES | CN(C(=O)c1cn(C2CCNCC2)nn1)C1CCCC1.Cl |
| InChI | InChI=1S/C14H23N5O.ClH/c1-18(11-4-2-3-5-11)14(20)13-10-19(17-16-13)12-6-8-15-9-7-12;/h10-12,15H,2-9H2,1H3;1H |
| InChIKey | YKBAQDOUZPGUCV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |