C13H22N6O — CID 79315997
1-(azetidin-3-yl)-N-methyl-N-(1-methylpiperidin-3-yl)triazole-4-carboxamide (PubChem CID 79315997) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-N-methyl-N-(1-methylpiperidin-3-yl)triazole-4-carboxamide.
| Compound Name | 1-(azetidin-3-yl)-N-methyl-N-(1-methylpiperidin-3-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 79315997 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-(azetidin-3-yl)-N-methyl-N-(1-methylpiperidin-3-yl)triazole-4-carboxamide |
| SMILES | CN1CCCC(N(C)C(=O)c2cn(C3CNC3)nn2)C1 |
| InChI | InChI=1S/C13H22N6O/c1-17-5-3-4-10(8-17)18(2)13(20)12-9-19(16-15-12)11-6-14-7-11/h9-11,14H,3-8H2,1-2H3 |
| InChIKey | RTKRODKISMHTIR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |