C14H22N4O3S2 — CID 167809282
3-[2-[(1-cyclohexyltriazole-4-carbonyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 167809282) has the molecular formula C14H22N4O3S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-[2-[(1-cyclohexyltriazole-4-carbonyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(1-cyclohexyltriazole-4-carbonyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167809282 |
| Molecular Formula | C14H22N4O3S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-[2-[(1-cyclohexyltriazole-4-carbonyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)c1cn(C2CCCCC2)nn1 |
| InChI | InChI=1S/C14H22N4O3S2/c19-13(20)6-8-22-23-9-7-15-14(21)12-10-18(17-16-12)11-4-2-1-3-5-11/h10-11H,1-9H2,(H,15,21)(H,19,20) |
| InChIKey | VWHLNUBFECWRMZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|