C11H17ClF3N5OS — CID 119727706
1-piperidin-4-yl-N-[2-(trifluoromethylsulfanyl)ethyl]triazole-4-carboxamide;hydrochloride (PubChem CID 119727706) has the molecular formula C11H17ClF3N5OS and a molecular weight of 359.81 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[2-(trifluoromethylsulfanyl)ethyl]triazole-4-carboxamide;hydrochloride.
| Compound Name | 1-piperidin-4-yl-N-[2-(trifluoromethylsulfanyl)ethyl]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119727706 |
| Molecular Formula | C11H17ClF3N5OS |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 1-piperidin-4-yl-N-[2-(trifluoromethylsulfanyl)ethyl]triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCSC(F)(F)F)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C11H16F3N5OS.ClH/c12-11(13,14)21-6-5-16-10(20)9-7-19(18-17-9)8-1-3-15-4-2-8;/h7-8,15H,1-6H2,(H,16,20);1H |
| InChIKey | CZXSLAMNEOIDHK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|