C17H21ClF3N5O2 — CID 119736753
1-piperidin-4-yl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]triazole-4-carboxamide;hydrochloride (PubChem CID 119736753) has the molecular formula C17H21ClF3N5O2 and a molecular weight of 419.84 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]triazole-4-carboxamide;hydrochloride.
| Compound Name | 1-piperidin-4-yl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119736753 |
| Molecular Formula | C17H21ClF3N5O2 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-piperidin-4-yl-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCOc1ccc(C(F)(F)F)cc1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C17H20F3N5O2.ClH/c18-17(19,20)12-1-3-14(4-2-12)27-10-9-22-16(26)15-11-25(24-23-15)13-5-7-21-8-6-13;/h1-4,11,13,21H,5-10H2,(H,22,26);1H |
| InChIKey | RDUKEJLIGQQJKR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|