C17H20F3N5O2 — CID 119721502
1-piperidin-4-yl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]triazole-4-carboxamide (PubChem CID 119721502) has the molecular formula C17H20F3N5O2 and a molecular weight of 383.37 g/mol. Its IUPAC name is 1-piperidin-4-yl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]triazole-4-carboxamide.
| Compound Name | 1-piperidin-4-yl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119721502 |
| Molecular Formula | C17H20F3N5O2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-piperidin-4-yl-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]triazole-4-carboxamide |
| SMILES | O=C(NCCc1ccc(OC(F)(F)F)cc1)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C17H20F3N5O2/c18-17(19,20)27-14-3-1-12(2-4-14)5-10-22-16(26)15-11-25(24-23-15)13-6-8-21-9-7-13/h1-4,11,13,21H,5-10H2,(H,22,26) |
| InChIKey | AEKZMCQEQWAOBV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |