C14H25BN4O3 — CID 155512795
[(1R)-1-[(1-cyclohexyltriazole-4-carbonyl)amino]-3-methylbutyl]boronic acid (PubChem CID 155512795) has the molecular formula C14H25BN4O3 and a molecular weight of 308.19 g/mol. Its IUPAC name is [(1R)-1-[(1-cyclohexyltriazole-4-carbonyl)amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[(1-cyclohexyltriazole-4-carbonyl)amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 155512795 |
| Molecular Formula | C14H25BN4O3 |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | [(1R)-1-[(1-cyclohexyltriazole-4-carbonyl)amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1cn(C2CCCCC2)nn1)B(O)O |
| InChI | InChI=1S/C14H25BN4O3/c1-10(2)8-13(15(21)22)16-14(20)12-9-19(18-17-12)11-6-4-3-5-7-11/h9-11,13,21-22H,3-8H2,1-2H3,(H,16,20)/t13-/m0/s1 |
| InChIKey | CZNHJEDLONNLAH-ZDUSSCGKSA-N |
| XLogP | 0.94 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|