C18H30N4O3 — CID 45227567
ethyl 3-[(1-cyclohexyltriazole-4-carbonyl)amino]heptanoate (PubChem CID 45227567) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethyl 3-[(1-cyclohexyltriazole-4-carbonyl)amino]heptanoate.
| Compound Name | ethyl 3-[(1-cyclohexyltriazole-4-carbonyl)amino]heptanoate |
|---|---|
| PubChem CID | 45227567 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | ethyl 3-[(1-cyclohexyltriazole-4-carbonyl)amino]heptanoate |
| SMILES | CCCCC(CC(=O)OCC)NC(=O)c1cn(C2CCCCC2)nn1 |
| InChI | InChI=1S/C18H30N4O3/c1-3-5-9-14(12-17(23)25-4-2)19-18(24)16-13-22(21-20-16)15-10-7-6-8-11-15/h13-15H,3-12H2,1-2H3,(H,19,24) |
| InChIKey | VIQPZFAITQWVRE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |