C18H23ClN4O3 — CID 45219680
ethyl 3-[[1-[(4-chlorophenyl)methyl]triazole-4-carbonyl]amino]hexanoate (PubChem CID 45219680) has the molecular formula C18H23ClN4O3 and a molecular weight of 378.86 g/mol. Its IUPAC name is ethyl 3-[[1-[(4-chlorophenyl)methyl]triazole-4-carbonyl]amino]hexanoate.
| Compound Name | ethyl 3-[[1-[(4-chlorophenyl)methyl]triazole-4-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 45219680 |
| Molecular Formula | C18H23ClN4O3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | ethyl 3-[[1-[(4-chlorophenyl)methyl]triazole-4-carbonyl]amino]hexanoate |
| SMILES | CCCC(CC(=O)OCC)NC(=O)c1cn(Cc2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C18H23ClN4O3/c1-3-5-15(10-17(24)26-4-2)20-18(25)16-12-23(22-21-16)11-13-6-8-14(19)9-7-13/h6-9,12,15H,3-5,10-11H2,1-2H3,(H,20,25) |
| InChIKey | JGQWOJBMAVZXNO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |