C16H19FN4O3 — CID 95722583
ethyl (3S)-3-[[1-[(2-fluorophenyl)methyl]triazole-4-carbonyl]amino]butanoate (PubChem CID 95722583) has the molecular formula C16H19FN4O3 and a molecular weight of 334.35 g/mol. Its IUPAC name is ethyl (3S)-3-[[1-[(2-fluorophenyl)methyl]triazole-4-carbonyl]amino]butanoate.
| Compound Name | ethyl (3S)-3-[[1-[(2-fluorophenyl)methyl]triazole-4-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 95722583 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | ethyl (3S)-3-[[1-[(2-fluorophenyl)methyl]triazole-4-carbonyl]amino]butanoate |
| SMILES | CCOC(=O)C[C@H](C)NC(=O)c1cn(Cc2ccccc2F)nn1 |
| InChI | InChI=1S/C16H19FN4O3/c1-3-24-15(22)8-11(2)18-16(23)14-10-21(20-19-14)9-12-6-4-5-7-13(12)17/h4-7,10-11H,3,8-9H2,1-2H3,(H,18,23)/t11-/m0/s1 |
| InChIKey | IRDFHRWOJSBKMR-NSHDSACASA-N |
| XLogP | 1.54 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |