C22H21FN6O — CID 26390849
1-[(2-fluorophenyl)methyl]-N-[(1R)-3-imidazol-1-yl-1-phenylpropyl]triazole-4-carboxamide (PubChem CID 26390849) has the molecular formula C22H21FN6O and a molecular weight of 404.45 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-[(1R)-3-imidazol-1-yl-1-phenylpropyl]triazole-4-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-[(1R)-3-imidazol-1-yl-1-phenylpropyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 26390849 |
| Molecular Formula | C22H21FN6O |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-[(1R)-3-imidazol-1-yl-1-phenylpropyl]triazole-4-carboxamide |
| SMILES | O=C(N[C@H](CCn1ccnc1)c1ccccc1)c1cn(Cc2ccccc2F)nn1 |
| InChI | InChI=1S/C22H21FN6O/c23-19-9-5-4-8-18(19)14-29-15-21(26-27-29)22(30)25-20(17-6-2-1-3-7-17)10-12-28-13-11-24-16-28/h1-9,11,13,15-16,20H,10,12,14H2,(H,25,30)/t20-/m1/s1 |
| InChIKey | PGMUZYGSNFGFOK-HXUWFJFHSA-N |
| XLogP | 3.22 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |