C10H14N6O2 — CID 103247747
1-[2-(2-imidazol-1-ylethylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 103247747) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-[2-(2-imidazol-1-ylethylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-imidazol-1-ylethylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103247747 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-[2-(2-imidazol-1-ylethylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCNCCn2ccnc2)nn1 |
| InChI | InChI=1S/C10H14N6O2/c17-10(18)9-7-16(14-13-9)6-3-11-1-4-15-5-2-12-8-15/h2,5,7-8,11H,1,3-4,6H2,(H,17,18) |
| InChIKey | JFGDPNRETPKNPE-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|