C11H21N5O3 — CID 114128422
1-[2-[2-[2-(dimethylamino)ethoxy]ethylamino]ethyl]triazole-4-carboxylic acid (PubChem CID 114128422) has the molecular formula C11H21N5O3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-[2-[2-[2-(dimethylamino)ethoxy]ethylamino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[2-[2-(dimethylamino)ethoxy]ethylamino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114128422 |
| Molecular Formula | C11H21N5O3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-[2-[2-[2-(dimethylamino)ethoxy]ethylamino]ethyl]triazole-4-carboxylic acid |
| SMILES | CN(C)CCOCCNCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H21N5O3/c1-15(2)6-8-19-7-4-12-3-5-16-9-10(11(17)18)13-14-16/h9,12H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | VHGVIJKJBKSRLP-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|