C8H14N4O4 — CID 103261684
1-[2-(2-methoxyethoxyamino)ethyl]triazole-4-carboxylic acid (PubChem CID 103261684) has the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxyamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-methoxyethoxyamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103261684 |
| Molecular Formula | C8H14N4O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 1-[2-(2-methoxyethoxyamino)ethyl]triazole-4-carboxylic acid |
| SMILES | COCCONCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C8H14N4O4/c1-15-4-5-16-9-2-3-12-6-7(8(13)14)10-11-12/h6,9H,2-5H2,1H3,(H,13,14) |
| InChIKey | PHSQNLATBHZJLY-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|