C6H11N5O2 — CID 63587191
1-(2-methoxyethyl)triazole-4-carbohydrazide (PubChem CID 63587191) has the molecular formula C6H11N5O2 and a molecular weight of 185.19 g/mol. Its IUPAC name is 1-(2-methoxyethyl)triazole-4-carbohydrazide.
| Compound Name | 1-(2-methoxyethyl)triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63587191 |
| Molecular Formula | C6H11N5O2 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-(2-methoxyethyl)triazole-4-carbohydrazide |
| SMILES | COCCn1cc(C(=O)NN)nn1 |
| InChI | InChI=1S/C6H11N5O2/c1-13-3-2-11-4-5(9-10-11)6(12)8-7/h4H,2-3,7H2,1H3,(H,8,12) |
| InChIKey | SOBVOJYBWAJHNH-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|