C13H17N5O3 — CID 63575381
1-[2-[(4-methoxyphenyl)methoxy]ethyl]triazole-4-carbohydrazide (PubChem CID 63575381) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-[2-[(4-methoxyphenyl)methoxy]ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-[(4-methoxyphenyl)methoxy]ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63575381 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-[2-[(4-methoxyphenyl)methoxy]ethyl]triazole-4-carbohydrazide |
| SMILES | COc1ccc(COCCn2cc(C(=O)NN)nn2)cc1 |
| InChI | InChI=1S/C13H17N5O3/c1-20-11-4-2-10(3-5-11)9-21-7-6-18-8-12(16-17-18)13(19)15-14/h2-5,8H,6-7,9,14H2,1H3,(H,15,19) |
| InChIKey | NZCBAWXXRRMCSD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|