C8H13N5O2 — CID 63575951
1-(2-prop-2-enoxyethyl)triazole-4-carbohydrazide (PubChem CID 63575951) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(2-prop-2-enoxyethyl)triazole-4-carbohydrazide.
| Compound Name | 1-(2-prop-2-enoxyethyl)triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63575951 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-(2-prop-2-enoxyethyl)triazole-4-carbohydrazide |
| SMILES | C=CCOCCn1cc(C(=O)NN)nn1 |
| InChI | InChI=1S/C8H13N5O2/c1-2-4-15-5-3-13-6-7(11-12-13)8(14)10-9/h2,6H,1,3-5,9H2,(H,10,14) |
| InChIKey | URZBWMBAHOJXNN-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|