C11H10Cl3N5O2 — CID 63576124
1-[2-(2,4,6-trichlorophenoxy)ethyl]triazole-4-carbohydrazide (PubChem CID 63576124) has the molecular formula C11H10Cl3N5O2 and a molecular weight of 350.59 g/mol. Its IUPAC name is 1-[2-(2,4,6-trichlorophenoxy)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(2,4,6-trichlorophenoxy)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63576124 |
| Molecular Formula | C11H10Cl3N5O2 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 1-[2-(2,4,6-trichlorophenoxy)ethyl]triazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cn(CCOc2c(Cl)cc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C11H10Cl3N5O2/c12-6-3-7(13)10(8(14)4-6)21-2-1-19-5-9(17-18-19)11(20)16-15/h3-5H,1-2,15H2,(H,16,20) |
| InChIKey | MUGGCWUPXVSSHM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|