C12H14ClN5O2 — CID 63586475
1-[2-[(2-chlorophenyl)methoxy]ethyl]triazole-4-carbohydrazide (PubChem CID 63586475) has the molecular formula C12H14ClN5O2 and a molecular weight of 295.73 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methoxy]ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-[(2-chlorophenyl)methoxy]ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63586475 |
| Molecular Formula | C12H14ClN5O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methoxy]ethyl]triazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cn(CCOCc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C12H14ClN5O2/c13-10-4-2-1-3-9(10)8-20-6-5-18-7-11(16-17-18)12(19)15-14/h1-4,7H,5-6,8,14H2,(H,15,19) |
| InChIKey | HLSFNXNHPCCUIS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|