C10H17N5O3 — CID 63568612
1-[2-(oxolan-3-ylmethoxy)ethyl]triazole-4-carbohydrazide (PubChem CID 63568612) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-[2-(oxolan-3-ylmethoxy)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(oxolan-3-ylmethoxy)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63568612 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-[2-(oxolan-3-ylmethoxy)ethyl]triazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cn(CCOCC2CCOC2)nn1 |
| InChI | InChI=1S/C10H17N5O3/c11-12-10(16)9-5-15(14-13-9)2-4-18-7-8-1-3-17-6-8/h5,8H,1-4,6-7,11H2,(H,12,16) |
| InChIKey | HUFJUEOVPBCTOZ-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|