C12H21N7O2 — CID 63579535
2-[1-[2-[4-(hydrazinecarbonyl)triazol-1-yl]ethyl]piperidin-4-yl]acetamide (PubChem CID 63579535) has the molecular formula C12H21N7O2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-[1-[2-[4-(hydrazinecarbonyl)triazol-1-yl]ethyl]piperidin-4-yl]acetamide.
| Compound Name | 2-[1-[2-[4-(hydrazinecarbonyl)triazol-1-yl]ethyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 63579535 |
| Molecular Formula | C12H21N7O2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[1-[2-[4-(hydrazinecarbonyl)triazol-1-yl]ethyl]piperidin-4-yl]acetamide |
| SMILES | NNC(=O)c1cn(CCN2CCC(CC(N)=O)CC2)nn1 |
| InChI | InChI=1S/C12H21N7O2/c13-11(20)7-9-1-3-18(4-2-9)5-6-19-8-10(16-17-19)12(21)15-14/h8-9H,1-7,14H2,(H2,13,20)(H,15,21) |
| InChIKey | CMUPKYJFQNRVAA-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|