C13H23N7O — CID 79164963
1-[2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)ethyl]triazole-4-carbohydrazide (PubChem CID 79164963) has the molecular formula C13H23N7O and a molecular weight of 293.38 g/mol. Its IUPAC name is 1-[2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 79164963 |
| Molecular Formula | C13H23N7O |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-[2-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)ethyl]triazole-4-carbohydrazide |
| SMILES | CN1C2CCC1CN(CCn1cc(C(=O)NN)nn1)CC2 |
| InChI | InChI=1S/C13H23N7O/c1-18-10-2-3-11(18)8-19(5-4-10)6-7-20-9-12(16-17-20)13(21)15-14/h9-11H,2-8,14H2,1H3,(H,15,21) |
| InChIKey | XXNSRLGZAPAWDH-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|