C12H22N6O3 — CID 114781911
1-[2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]ethyl]triazole-4-carbohydrazide (PubChem CID 114781911) has the molecular formula C12H22N6O3 and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-[2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 114781911 |
| Molecular Formula | C12H22N6O3 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-[2-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]ethyl]triazole-4-carbohydrazide |
| SMILES | CC1(C)CN(CCn2cc(C(=O)NN)nn2)CC(CO)O1 |
| InChI | InChI=1S/C12H22N6O3/c1-12(2)8-17(5-9(7-19)21-12)3-4-18-6-10(15-16-18)11(20)14-13/h6,9,19H,3-5,7-8,13H2,1-2H3,(H,14,20) |
| InChIKey | MBJLTALBJUCTKG-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|