C12H22N6O2 — CID 63573572
1-[2-(4-ethoxypiperidin-1-yl)ethyl]triazole-4-carbohydrazide (PubChem CID 63573572) has the molecular formula C12H22N6O2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-[2-(4-ethoxypiperidin-1-yl)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(4-ethoxypiperidin-1-yl)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63573572 |
| Molecular Formula | C12H22N6O2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-[2-(4-ethoxypiperidin-1-yl)ethyl]triazole-4-carbohydrazide |
| SMILES | CCOC1CCN(CCn2cc(C(=O)NN)nn2)CC1 |
| InChI | InChI=1S/C12H22N6O2/c1-2-20-10-3-5-17(6-4-10)7-8-18-9-11(15-16-18)12(19)14-13/h9-10H,2-8,13H2,1H3,(H,14,19) |
| InChIKey | OBKYTAKJJUNYGQ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|