C10H19N7O3S — CID 63572290
1-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]triazole-4-carbohydrazide (PubChem CID 63572290) has the molecular formula C10H19N7O3S and a molecular weight of 317.38 g/mol. Its IUPAC name is 1-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63572290 |
| Molecular Formula | C10H19N7O3S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]triazole-4-carbohydrazide |
| SMILES | CS(=O)(=O)N1CCN(CCn2cc(C(=O)NN)nn2)CC1 |
| InChI | InChI=1S/C10H19N7O3S/c1-21(19,20)17-6-3-15(4-7-17)2-5-16-8-9(13-14-16)10(18)12-11/h8H,2-7,11H2,1H3,(H,12,18) |
| InChIKey | OEQAYNRWDWFIKB-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|