C10H16N6O2 — CID 63579377
1-[2-(2-oxopiperidin-1-yl)ethyl]triazole-4-carbohydrazide (PubChem CID 63579377) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-[2-(2-oxopiperidin-1-yl)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(2-oxopiperidin-1-yl)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63579377 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-[2-(2-oxopiperidin-1-yl)ethyl]triazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cn(CCN2CCCCC2=O)nn1 |
| InChI | InChI=1S/C10H16N6O2/c11-12-10(18)8-7-16(14-13-8)6-5-15-4-2-1-3-9(15)17/h7H,1-6,11H2,(H,12,18) |
| InChIKey | SNVZVWAPSFKGAS-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|