C19H34N6O — CID 45218907
1-[2-[4-(cyclohexylmethyl)piperazin-1-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide (PubChem CID 45218907) has the molecular formula C19H34N6O and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-[2-[4-(cyclohexylmethyl)piperazin-1-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide.
| Compound Name | 1-[2-[4-(cyclohexylmethyl)piperazin-1-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 45218907 |
| Molecular Formula | C19H34N6O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1-[2-[4-(cyclohexylmethyl)piperazin-1-yl]ethyl]-N-propan-2-yltriazole-4-carboxamide |
| SMILES | CC(C)NC(=O)c1cn(CCN2CCN(CC3CCCCC3)CC2)nn1 |
| InChI | InChI=1S/C19H34N6O/c1-16(2)20-19(26)18-15-25(22-21-18)13-12-23-8-10-24(11-9-23)14-17-6-4-3-5-7-17/h15-17H,3-14H2,1-2H3,(H,20,26) |
| InChIKey | QDDYBCGTUBNKOW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |