C15H28N4O5 — CID 130468342
1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N-propan-2-yltriazole-4-carboxamide (PubChem CID 130468342) has the molecular formula C15H28N4O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N-propan-2-yltriazole-4-carboxamide.
| Compound Name | 1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 130468342 |
| Molecular Formula | C15H28N4O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-N-propan-2-yltriazole-4-carboxamide |
| SMILES | COCCOCCOCCOCCn1cc(C(=O)NC(C)C)nn1 |
| InChI | InChI=1S/C15H28N4O5/c1-13(2)16-15(20)14-12-19(18-17-14)4-5-22-8-9-24-11-10-23-7-6-21-3/h12-13H,4-11H2,1-3H3,(H,16,20) |
| InChIKey | GTVAESFHGIEMLG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|