C14H29N3O4 — CID 156729649
ethane;1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-4-methyltriazole (PubChem CID 156729649) has the molecular formula C14H29N3O4 and a molecular weight of 303.40 g/mol. Its IUPAC name is ethane;1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-4-methyltriazole.
| Compound Name | ethane;1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-4-methyltriazole |
|---|---|
| PubChem CID | 156729649 |
| Molecular Formula | C14H29N3O4 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | ethane;1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]-4-methyltriazole |
| SMILES | CC.COCCOCCOCCOCCn1cc(C)nn1 |
| InChI | InChI=1S/C12H23N3O4.C2H6/c1-12-11-15(14-13-12)3-4-17-7-8-19-10-9-18-6-5-16-2;1-2/h11H,3-10H2,1-2H3;1-2H3 |
| InChIKey | VDYCNNBXQNXHSH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|