C17H36N4O3 — CID 177359615
ethane;6-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethylamino]hexan-1-ol (PubChem CID 177359615) has the molecular formula C17H36N4O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is ethane;6-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethylamino]hexan-1-ol.
| Compound Name | ethane;6-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethylamino]hexan-1-ol |
|---|---|
| PubChem CID | 177359615 |
| Molecular Formula | C17H36N4O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | ethane;6-[2-[2-[2-(4-methyltriazol-1-yl)ethoxy]ethoxy]ethylamino]hexan-1-ol |
| SMILES | CC.Cc1cn(CCOCCOCCNCCCCCCO)nn1 |
| InChI | InChI=1S/C15H30N4O3.C2H6/c1-15-14-19(18-17-15)8-11-22-13-12-21-10-7-16-6-4-2-3-5-9-20;1-2/h14,16,20H,2-13H2,1H3;1-2H3 |
| InChIKey | MVTGYIBICOFQMN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|