C11H20N3O4P — CID 161061411
methyl-[5-[2-(4-methyltriazol-1-yl)ethoxy]-2-oxopentyl]phosphinic acid (PubChem CID 161061411) has the molecular formula C11H20N3O4P and a molecular weight of 289.27 g/mol. Its IUPAC name is methyl-[5-[2-(4-methyltriazol-1-yl)ethoxy]-2-oxopentyl]phosphinic acid.
| Compound Name | methyl-[5-[2-(4-methyltriazol-1-yl)ethoxy]-2-oxopentyl]phosphinic acid |
|---|---|
| PubChem CID | 161061411 |
| Molecular Formula | C11H20N3O4P |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | methyl-[5-[2-(4-methyltriazol-1-yl)ethoxy]-2-oxopentyl]phosphinic acid |
| SMILES | Cc1cn(CCOCCCC(=O)CP(C)(=O)O)nn1 |
| InChI | InChI=1S/C11H20N3O4P/c1-10-8-14(13-12-10)5-7-18-6-3-4-11(15)9-19(2,16)17/h8H,3-7,9H2,1-2H3,(H,16,17) |
| InChIKey | SLHIQNBZDGTCAI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|