C23H38N3O8PSi — CID 160521411
4-[1-[2-[2-[5-[3-[hydroxy(dimethyl)silyl]phenyl]-4-oxopentoxy]ethoxy]ethyl]triazol-4-yl]butyl dihydrogen phosphate (PubChem CID 160521411) has the molecular formula C23H38N3O8PSi and a molecular weight of 543.63 g/mol. Its IUPAC name is 4-[1-[2-[2-[5-[3-[hydroxy(dimethyl)silyl]phenyl]-4-oxopentoxy]ethoxy]ethyl]triazol-4-yl]butyl dihydrogen phosphate.
| Compound Name | 4-[1-[2-[2-[5-[3-[hydroxy(dimethyl)silyl]phenyl]-4-oxopentoxy]ethoxy]ethyl]triazol-4-yl]butyl dihydrogen phosphate |
|---|---|
| PubChem CID | 160521411 |
| Molecular Formula | C23H38N3O8PSi |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 4-[1-[2-[2-[5-[3-[hydroxy(dimethyl)silyl]phenyl]-4-oxopentoxy]ethoxy]ethyl]triazol-4-yl]butyl dihydrogen phosphate |
| SMILES | C[Si](C)(O)c1cccc(CC(=O)CCCOCCOCCn2cc(CCCCOP(=O)(O)O)nn2)c1 |
| InChI | InChI=1S/C23H38N3O8PSi/c1-36(2,31)23-10-5-7-20(18-23)17-22(27)9-6-12-32-15-16-33-14-11-26-19-21(24-25-26)8-3-4-13-34-35(28,29)30/h5,7,10,18-19,31H,3-4,6,8-9,11-17H2,1-2H3,(H2,28,29,30) |
| InChIKey | OBLUUQSIPBNPNO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 153.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|