C14H27N4O5P — CID 170288871
methyl 4-[1-[6-(methylamino)-6-oxohexyl]triazol-4-yl]butyl hydrogen phosphate (PubChem CID 170288871) has the molecular formula C14H27N4O5P and a molecular weight of 362.37 g/mol. Its IUPAC name is methyl 4-[1-[6-(methylamino)-6-oxohexyl]triazol-4-yl]butyl hydrogen phosphate.
| Compound Name | methyl 4-[1-[6-(methylamino)-6-oxohexyl]triazol-4-yl]butyl hydrogen phosphate |
|---|---|
| PubChem CID | 170288871 |
| Molecular Formula | C14H27N4O5P |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | methyl 4-[1-[6-(methylamino)-6-oxohexyl]triazol-4-yl]butyl hydrogen phosphate |
| SMILES | CNC(=O)CCCCCn1cc(CCCCOP(=O)(O)OC)nn1 |
| InChI | InChI=1S/C14H27N4O5P/c1-15-14(19)9-4-3-6-10-18-12-13(16-17-18)8-5-7-11-23-24(20,21)22-2/h12H,3-11H2,1-2H3,(H,15,19)(H,20,21) |
| InChIKey | JSFWEORZETVCNM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|