C9H19N4O4P — CID 172570739
2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate (PubChem CID 172570739) has the molecular formula C9H19N4O4P and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate.
| Compound Name | 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate |
|---|---|
| PubChem CID | 172570739 |
| Molecular Formula | C9H19N4O4P |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate |
| SMILES | Cn1cc(CCCCOP(=O)(O)OCCN)nn1 |
| InChI | InChI=1S/C9H19N4O4P/c1-13-8-9(11-12-13)4-2-3-6-16-18(14,15)17-7-5-10/h8H,2-7,10H2,1H3,(H,14,15) |
| InChIKey | SILZQPFAKHMDRM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|