2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate

C9H19N4O4P — CID 172570739

IUPAC2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate
SMILESCn1cc(CCCCOP(=O)(O)OCCN)nn1
InChIInChI=1S/C9H19N4O4P/c1-13-8-9(11-12-13)4-2-3-6-16-18(14,15)17-7-5-10/h8H,2-7,10H2,1H3,(H,14,15)
InChIKeySILZQPFAKHMDRM-UHFFFAOYSA-N
MW278.25 g/mol
LogP0.23
Rot. Bonds9

About 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate

2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate (PubChem CID 172570739) has the molecular formula C9H19N4O4P and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate.

Molecular Properties

Compound Name2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate
PubChem CID172570739
Molecular FormulaC9H19N4O4P
Molecular Weight278.25 g/mol
Exact Mass278.11
IUPAC Name2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate
SMILESCn1cc(CCCCOP(=O)(O)OCCN)nn1
InChIInChI=1S/C9H19N4O4P/c1-13-8-9(11-12-13)4-2-3-6-16-18(14,15)17-7-5-10/h8H,2-7,10H2,1H3,(H,14,15)
InChIKeySILZQPFAKHMDRM-UHFFFAOYSA-N
XLogP0.23
TPSA112.49 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds9
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.25
LogP ≤ 50.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate?
The IUPAC name of 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate (CID 172570739) is 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate.
What is the SMILES notation for 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate?
The canonical SMILES for 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate is Cn1cc(CCCCOP(=O)(O)OCCN)nn1.
What is the InChIKey of 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate?
The InChIKey is SILZQPFAKHMDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N4O4P/c1-13-8-9(11-12-13)4-2-3-6-16-18(14,15)17-7-5-10/h8H,2-7,10H2,1H3,(H,14,15).
What are the key properties of 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate?
2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate has a molecular weight of 278.25 g/mol, XLogP of 0.23, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 4-(1-methyltriazol-4-yl)butyl hydrogen phosphate is sourced from PubChem (CID 172570739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).