C7H15N5 — CID 70457819
N'-[2-(1-methyltriazol-4-yl)ethyl]ethane-1,2-diamine (PubChem CID 70457819) has the molecular formula C7H15N5 and a molecular weight of 169.23 g/mol. Its IUPAC name is N'-[2-(1-methyltriazol-4-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(1-methyltriazol-4-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 70457819 |
| Molecular Formula | C7H15N5 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | N'-[2-(1-methyltriazol-4-yl)ethyl]ethane-1,2-diamine |
| SMILES | Cn1cc(CCNCCN)nn1 |
| InChI | InChI=1S/C7H15N5/c1-12-6-7(10-11-12)2-4-9-5-3-8/h6,9H,2-5,8H2,1H3 |
| InChIKey | ITJFNKXAGMEOQK-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|