C10H15N5S — CID 103698521
2-(2-methyl-1,3-thiazol-4-yl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 103698521) has the molecular formula C10H15N5S and a molecular weight of 237.33 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103698521 |
| Molecular Formula | C10H15N5S |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | Cc1nc(CCNCc2cn(C)nn2)cs1 |
| InChI | InChI=1S/C10H15N5S/c1-8-12-9(7-16-8)3-4-11-5-10-6-15(2)14-13-10/h6-7,11H,3-5H2,1-2H3 |
| InChIKey | SQSDFNCPPOFLMJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|