C8H12F2N2S — CID 106045224
2,2-difluoro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]ethanamine (PubChem CID 106045224) has the molecular formula C8H12F2N2S and a molecular weight of 206.26 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]ethanamine.
| Compound Name | 2,2-difluoro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 106045224 |
| Molecular Formula | C8H12F2N2S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2,2-difluoro-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]ethanamine |
| SMILES | Cc1nc(CCNCC(F)F)cs1 |
| InChI | InChI=1S/C8H12F2N2S/c1-6-12-7(5-13-6)2-3-11-4-8(9)10/h5,8,11H,2-4H2,1H3 |
| InChIKey | JLILBBPKXOTAOA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|