C15H28N2S — CID 106045197
N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]nonan-1-amine (PubChem CID 106045197) has the molecular formula C15H28N2S and a molecular weight of 268.47 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]nonan-1-amine.
| Compound Name | N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]nonan-1-amine |
|---|---|
| PubChem CID | 106045197 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]nonan-1-amine |
| SMILES | CCCCCCCCCNCCc1csc(C)n1 |
| InChI | InChI=1S/C15H28N2S/c1-3-4-5-6-7-8-9-11-16-12-10-15-13-18-14(2)17-15/h13,16H,3-12H2,1-2H3 |
| InChIKey | RCUDQLHCWNQBNR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|