C13H25N3S — CID 62428102
N'-methyl-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-propylbutane-1,4-diamine (PubChem CID 62428102) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is N'-methyl-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-propylbutane-1,4-diamine.
| Compound Name | N'-methyl-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-propylbutane-1,4-diamine |
|---|---|
| PubChem CID | 62428102 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N'-methyl-N'-[(2-methyl-1,3-thiazol-4-yl)methyl]-N-propylbutane-1,4-diamine |
| SMILES | CCCNCCCCN(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C13H25N3S/c1-4-7-14-8-5-6-9-16(3)10-13-11-17-12(2)15-13/h11,14H,4-10H2,1-3H3 |
| InChIKey | JLPVUBGTZAXNST-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|