C11H20N4OS — CID 76930176
N'-hydroxy-5-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pentanimidamide (PubChem CID 76930176) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is N'-hydroxy-5-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pentanimidamide.
| Compound Name | N'-hydroxy-5-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pentanimidamide |
|---|---|
| PubChem CID | 76930176 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N'-hydroxy-5-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]pentanimidamide |
| SMILES | Cc1nc(CN(C)CCCCC(N)=NO)cs1 |
| InChI | InChI=1S/C11H20N4OS/c1-9-13-10(8-17-9)7-15(2)6-4-3-5-11(12)14-16/h8,16H,3-7H2,1-2H3,(H2,12,14) |
| InChIKey | KASICQLHXOYHGM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|