C6H9N3OS — CID 57374618
N'-hydroxy-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide (PubChem CID 57374618) has the molecular formula C6H9N3OS and a molecular weight of 171.23 g/mol. Its IUPAC name is N'-hydroxy-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide.
| Compound Name | N'-hydroxy-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
|---|---|
| PubChem CID | 57374618 |
| Molecular Formula | C6H9N3OS |
| Molecular Weight | 171.23 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | N'-hydroxy-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
| SMILES | Cc1nc(CC(N)=NO)cs1 |
| InChI | InChI=1S/C6H9N3OS/c1-4-8-5(3-11-4)2-6(7)9-10/h3,10H,2H2,1H3,(H2,7,9) |
| InChIKey | CBJSFKRUIVTFJQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|