C13H13Cl2N3OS — CID 75268261
N'-[(3,4-dichlorophenyl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide (PubChem CID 75268261) has the molecular formula C13H13Cl2N3OS and a molecular weight of 330.24 g/mol. Its IUPAC name is N'-[(3,4-dichlorophenyl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide.
| Compound Name | N'-[(3,4-dichlorophenyl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
|---|---|
| PubChem CID | 75268261 |
| Molecular Formula | C13H13Cl2N3OS |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | N'-[(3,4-dichlorophenyl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
| SMILES | Cc1nc(CC(N)=NOCc2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C13H13Cl2N3OS/c1-8-17-10(7-20-8)5-13(16)18-19-6-9-2-3-11(14)12(15)4-9/h2-4,7H,5-6H2,1H3,(H2,16,18) |
| InChIKey | RHHQPHUXMBHPRY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|