C17H23N3OS — CID 76889643
N'-[(4-tert-butylphenyl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide (PubChem CID 76889643) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is N'-[(4-tert-butylphenyl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide.
| Compound Name | N'-[(4-tert-butylphenyl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
|---|---|
| PubChem CID | 76889643 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N'-[(4-tert-butylphenyl)methoxy]-2-(2-methyl-1,3-thiazol-4-yl)ethanimidamide |
| SMILES | Cc1nc(CC(N)=NOCc2ccc(C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C17H23N3OS/c1-12-19-15(11-22-12)9-16(18)20-21-10-13-5-7-14(8-6-13)17(2,3)4/h5-8,11H,9-10H2,1-4H3,(H2,18,20) |
| InChIKey | HNCVOVUIARTAQD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|