C14H14N4O2S2 — CID 76889666
2-(2-methyl-1,3-thiazol-4-yl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]ethanimidamide (PubChem CID 76889666) has the molecular formula C14H14N4O2S2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]ethanimidamide.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]ethanimidamide |
|---|---|
| PubChem CID | 76889666 |
| Molecular Formula | C14H14N4O2S2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]ethanimidamide |
| SMILES | Cc1nc(CC(N)=NOCc2coc(-c3cccs3)n2)cs1 |
| InChI | InChI=1S/C14H14N4O2S2/c1-9-16-10(8-22-9)5-13(15)18-20-7-11-6-19-14(17-11)12-3-2-4-21-12/h2-4,6,8H,5,7H2,1H3,(H2,15,18) |
| InChIKey | KWLLBVBWXUEIOQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|