C22H19N3O3S — CID 56500734
2-phenylmethoxy-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzenecarboximidamide (PubChem CID 56500734) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-phenylmethoxy-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzenecarboximidamide.
| Compound Name | 2-phenylmethoxy-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 56500734 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-phenylmethoxy-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzenecarboximidamide |
| SMILES | N/C(=N/OCc1coc(-c2cccs2)n1)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H19N3O3S/c23-21(25-28-15-17-14-27-22(24-17)20-11-6-12-29-20)18-9-4-5-10-19(18)26-13-16-7-2-1-3-8-16/h1-12,14H,13,15H2,(H2,23,25) |
| InChIKey | FSPZEXHXYYKCCC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|