C15H11NO4S — CID 43214269
3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzoic acid (PubChem CID 43214269) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is 3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzoic acid.
| Compound Name | 3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 43214269 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCc2coc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C15H11NO4S/c17-15(18)10-3-1-4-12(7-10)19-8-11-9-20-14(16-11)13-5-2-6-21-13/h1-7,9H,8H2,(H,17,18) |
| InChIKey | VNIFRACPEZPJME-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |