C16H11NO4S — CID 7669328
(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 4-formylbenzoate (PubChem CID 7669328) has the molecular formula C16H11NO4S and a molecular weight of 313.33 g/mol. Its IUPAC name is (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 4-formylbenzoate.
| Compound Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 4-formylbenzoate |
|---|---|
| PubChem CID | 7669328 |
| Molecular Formula | C16H11NO4S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCc2coc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C16H11NO4S/c18-8-11-3-5-12(6-4-11)16(19)21-10-13-9-20-15(17-13)14-2-1-7-22-14/h1-9H,10H2 |
| InChIKey | RKZGQHOEJLLSJX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|