C15H11IN2O3S — CID 18169724
(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-amino-5-iodobenzoate (PubChem CID 18169724) has the molecular formula C15H11IN2O3S and a molecular weight of 426.24 g/mol. Its IUPAC name is (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-amino-5-iodobenzoate.
| Compound Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-amino-5-iodobenzoate |
|---|---|
| PubChem CID | 18169724 |
| Molecular Formula | C15H11IN2O3S |
| Molecular Weight | 426.24 g/mol |
| Exact Mass | 425.95 |
| IUPAC Name | (2-thiophen-2-yl-1,3-oxazol-4-yl)methyl 2-amino-5-iodobenzoate |
| SMILES | Nc1ccc(I)cc1C(=O)OCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C15H11IN2O3S/c16-9-3-4-12(17)11(6-9)15(19)21-8-10-7-20-14(18-10)13-2-1-5-22-13/h1-7H,8,17H2 |
| InChIKey | VTQDAXLZGKRVFL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.24 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|